Difference between revisions of "CPD-650"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008951001 == * left end position: ** 745790 * transcription direction: ** NEGATIVE * right end position: ** 747184 * centisome position: ** 81...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-650 CPD-650] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O |
| − | * | + | * molecular weight: |
| − | ** | + | ** 849.593 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (3R)-3-hydroxybutanoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-OH-butyryl-CoA | ||
| + | ** OH-butyryl-CoA | ||
| + | ** β-hydroxybutyryl-S-CoA | ||
| + | ** D-3-hydroxybutyryl-CoA | ||
| + | ** hydroxy-butyryl-CoA | ||
| + | ** β-hydroxybutyryl-CoA | ||
| + | ** 3-hydroxybutyryl-CoA | ||
| + | ** (3R)-3-Hydroxybutanoyl-CoA | ||
| + | ** 3-hydroxybutanoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[5.1.2.3-RXN]] | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57315 57315] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266552 45266552] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03561 C03561] |
| + | * UM-BBD-CPD : c0030 | ||
| + | * HMDB : HMDB01166 | ||
| + | {{#set: smiles=CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} | ||
| + | {{#set: molecular weight=849.593 }} | ||
| + | {{#set: inchi key=InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J}} | ||
| + | {{#set: common name=(3R)-3-hydroxybutanoyl-CoA}} | ||
| + | {{#set: common name=3-OH-butyryl-CoA|OH-butyryl-CoA|β-hydroxybutyryl-S-CoA|D-3-hydroxybutyryl-CoA|hydroxy-butyryl-CoA|β-hydroxybutyryl-CoA|3-hydroxybutyryl-CoA|(3R)-3-Hydroxybutanoyl-CoA|3-hydroxybutanoyl-CoA}} | ||
| + | {{#set: reversible reaction associated=5.1.2.3-RXN}} | ||
Latest revision as of 17:44, 9 January 2019
Contents
Metabolite CPD-650
- smiles:
- CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- molecular weight:
- 849.593
- inchi key:
- InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J
- common name:
- (3R)-3-hydroxybutanoyl-CoA
- Synonym(s):
- 3-OH-butyryl-CoA
- OH-butyryl-CoA
- β-hydroxybutyryl-S-CoA
- D-3-hydroxybutyryl-CoA
- hydroxy-butyryl-CoA
- β-hydroxybutyryl-CoA
- 3-hydroxybutyryl-CoA
- (3R)-3-Hydroxybutanoyl-CoA
- 3-hydroxybutanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.
