Difference between revisions of "RXN0-748"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * inchi key: ** InChIKey=U...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-748 RXN0-748] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ribonucleoside-diphosphate reductase beta chain |
− | * | + | ** ribonucleoside-diphosphate reductase alpha chain |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Reduced-NrdH-Proteins]][c] '''+''' 1 [[GDP]][c] '''=>''' 1 [[DGDP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Oxidized-NrdH-Proteins]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a reduced NrdH glutaredoxin-like protein[c] '''+''' 1 GDP[c] '''=>''' 1 dGDP[c] '''+''' 1 H2O[c] '''+''' 1 an oxidized NrdH glutaredoxin-like protein[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008864001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008926001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008864001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00008926001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-7222]], guanosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7222 PWY-7222] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ribonucleoside-diphosphate reductase beta chain}} | |
− | + | {{#set: common name=ribonucleoside-diphosphate reductase alpha chain}} | |
− | + | {{#set: ec number=EC-1.17.4.1}} | |
− | + | {{#set: gene associated=CHC_T00008864001_1|CHC_T00008926001_1|CHC_T00008864001|CHC_T00008926001}} | |
− | + | {{#set: in pathway=PWY-7222}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:41, 9 January 2019
Contents
Reaction RXN0-748
- direction:
- LEFT-TO-RIGHT
- common name:
- ribonucleoside-diphosphate reductase beta chain
- ribonucleoside-diphosphate reductase alpha chain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Reduced-NrdH-Proteins[c] + 1 GDP[c] => 1 DGDP[c] + 1 WATER[c] + 1 Oxidized-NrdH-Proteins[c]
- With common name(s):
- 1 a reduced NrdH glutaredoxin-like protein[c] + 1 GDP[c] => 1 dGDP[c] + 1 H2O[c] + 1 an oxidized NrdH glutaredoxin-like protein[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008864001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008926001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008864001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008926001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- PWY-7222, guanosine deoxyribonucleotides de novo biosynthesis II: PWY-7222
- 3 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome