Difference between revisions of "RXN-10089"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10089 RXN-10089] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
+
 
* common name:
 
* common name:
−
** XTP
+
** imidazole acetaldehyde reductase
−
* molecular weight:
+
** aldehyde dehydrogenase, (NAD) activity
−
** 520.136   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** xanthosine 5' triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-1603]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[IMIDAZOLE_ACETALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[4-IMIDAZOLEACETATE]][c] '''+''' 2 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 imidazole acetaldehyde[c] '''+''' 1 H2O[c] '''=>''' 1 NADH[c] '''+''' 1 4-imidazoleacetate[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008341001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008341001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00008575001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-6181]], histamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31059 31059]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04065 R04065]
−
* BIGG : xtp
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=imidazole acetaldehyde reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
+
{{#set: common name=aldehyde dehydrogenase, (NAD) activity}}
−
* HMDB : HMDB00293
+
{{#set: ec number=EC-1.2.1.3}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
+
{{#set: gene associated=CHC_T00008341001|CHC_T00008341001_1|CHC_T00008575001_1}}
−
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
+
{{#set: in pathway=PWY-6181}}
−
{{#set: common name=XTP}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=520.136    }}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
−
{{#set: common name=xanthosine 5' triphosphate}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed by=RXN0-1603}}
+

Latest revision as of 17:41, 9 January 2019

Reaction RXN-10089

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • imidazole acetaldehyde reductase
    • aldehyde dehydrogenase, (NAD) activity
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6181, histamine degradation: PWY-6181
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-10089&oldid=23388"