Difference between revisions of "CPD-3801"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008748001_1 == * Synonym(s): == Reactions associated == * RXN-11109 ** pantograph-galdieria.sulphuraria == Pathways associated ==...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008748001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] ==
 +
* smiles:
 +
** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
 +
* molecular weight:
 +
** 357.291   
 +
* inchi key:
 +
** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
 +
* common name:
 +
** melibionate
 
* Synonym(s):
 
* Synonym(s):
 +
** melibionic acid
 +
** 6-O-α-D-galactopyranosyl-D-gluconic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-11109]]
+
* [[RXN-17754]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-11109}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771]
 +
{{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}}
 +
{{#set: molecular weight=357.291    }}
 +
{{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}}
 +
{{#set: common name=melibionate}}
 +
{{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}}
 +
{{#set: consumed by=RXN-17754}}

Latest revision as of 17:45, 9 January 2019

Metabolite CPD-3801

  • smiles:
    • C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
  • molecular weight:
    • 357.291
  • inchi key:
    • InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
  • common name:
    • melibionate
  • Synonym(s):
    • melibionic acid
    • 6-O-α-D-galactopyranosyl-D-gluconic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.