Difference between revisions of "RXN-12196"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12196 RXN-12196] ==
* smiles:
+
* direction:
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
+
** [http://enzyme.expasy.org/EC/3.6.1.15 EC-3.6.1.15]
* common name:
+
** 14-hydroxylanosterol
+
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-304]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[UTP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
* [[RXN66-303]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 UTP[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 UDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00007176001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00005746001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00001236001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00006198001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00010157001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00004941001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00000060001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00159 R00159]
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
+
{{#set: ec number=EC-3.6.1.15}}
{{#set: common name=14-hydroxylanosterol}}
+
{{#set: gene associated=CHC_T00007176001_1|CHC_T00005746001_1|CHC_T00001236001_1|CHC_T00006198001_1|CHC_T00010157001_1|CHC_T00004941001_1|CHC_T00000060001_1}}
{{#set: molecular weight=442.724    }}
+
{{#set: in pathway=}}
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: reconstruction category=orthology}}
{{#set: consumed by=RXN66-304}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
{{#set: produced by=RXN66-303}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 18:43, 9 January 2019

Reaction RXN-12196

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 UTP[c] + 1 H2O[c] => 1 phosphate[c] + 1 H+[c] + 1 UDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links