Difference between revisions of "CPD-15616"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14812 RXN-14812] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
| + | * molecular weight: | ||
| + | ** 180.157 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N | ||
| + | * common name: | ||
| + | ** keto-L-sorbose | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[L-IDITOL-2-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC13172 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904] |
| + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | ||
| + | {{#set: molecular weight=180.157 }} | ||
| + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}} | ||
| + | {{#set: common name=keto-L-sorbose}} | ||
| + | {{#set: reversible reaction associated=L-IDITOL-2-DEHYDROGENASE-RXN}} | ||
Latest revision as of 17:49, 9 January 2019
Contents
Metabolite CPD-15616
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- molecular weight:
- 180.157
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
- common name:
- keto-L-sorbose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
