Difference between revisions of "RXN-17897"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17897 RXN-17897] ==
* smiles:
+
* direction:
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
+
** Ferredoxin-NADP+ oxidoreductase
* molecular weight:
+
* ec number:
** 262.262   
+
** [http://enzyme.expasy.org/EC/1.18.1.2 EC-1.18.1.2]
 
* Synonym(s):
 
* Synonym(s):
** salicyl-HCH
 
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 
** acylsaligenin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12252]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008519001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008519001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 529507-98-0
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=Ferredoxin-NADP+ oxidoreductase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
+
{{#set: ec number=EC-1.18.1.2}}
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
+
{{#set: gene associated=CHC_T00008519001|CHC_T00008519001_1}}
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
+
{{#set: in pathway=}}
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: molecular weight=262.262    }}
+
{{#set: reconstruction source=annotation-original_genome|orthology-arabidopsis_thaliana}}
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: consumed by=RXN-12252}}
+

Latest revision as of 18:45, 9 January 2019

Reaction RXN-17897

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Ferredoxin-NADP+ oxidoreductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links