Difference between revisions of "MALEATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9556 RXN-9556] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-cis-vaccenoyl-[acyl-car...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9556 RXN-9556] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C([O-])(=O)C=CC([O-])=O
 +
* molecular weight:
 +
** 114.057   
 +
* inchi key:
 +
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
 
* common name:
 
* common name:
** 3-oxo-cis-vaccenoyl-[acyl-carrier protein] reductase
+
** maleate
** 3-oxoacyl-[acyl-carrier-protein] reductase
+
** 3-oxoacyl-(acyl-carrier-protein) reductase
+
** beta-ketoacyl reductase
+
* ec number:
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** maleic acid
 +
** cis-butenedioic acid
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-oxo-cis-vaccenoyl-ACPs]][c] '''=>''' 1 [[R-3-hydroxy-cis-vaccenoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN-646]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a 3-oxo-cis-vacc-11-enoyl-[acp][c] '''=>''' 1 (R)-3-hydroxy-cis-vacc-11-enoyl-[acp][c] '''+''' 1 NADP+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008557001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008517001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008477001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008496001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 110-16-7
{{#set: common name=3-oxo-cis-vaccenoyl-[acyl-carrier protein] reductase}}
+
* HMDB : HMDB00176
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] reductase}}
+
* CHEMSPIDER:
{{#set: common name=3-oxoacyl-(acyl-carrier-protein) reductase}}
+
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
{{#set: common name=beta-ketoacyl reductase}}
+
* CHEBI:
{{#set: ec number=EC-1.1.1.100}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
{{#set: gene associated=CHC_T00008557001|CHC_T00008517001_1|CHC_T00008477001|CHC_T00008496001}}
+
* LIGAND-CPD:
{{#set: in pathway=PWY-5973}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
{{#set: reconstruction category=orthology}}
+
* PUBCHEM:
{{#set: reconstruction tool=pantograph}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=114.057    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
{{#set: reconstruction source=original_genome}}
+
{{#set: common name=maleate}}
 +
{{#set: common name=maleic acid|cis-butenedioic acid}}
 +
{{#set: produced by=RXN-646}}

Latest revision as of 17:51, 9 January 2019

Metabolite MALEATE

  • smiles:
    • C([O-])(=O)C=CC([O-])=O
  • molecular weight:
    • 114.057
  • inchi key:
    • InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
  • common name:
    • maleate
  • Synonym(s):
    • maleic acid
    • cis-butenedioic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C=CC([O-])=O" cannot be used as a page name in this wiki.