Difference between revisions of "CPD-17638"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS-tRNAs LYS-tRNAs] == * common name: ** a tRNAlys * Synonym(s): ** TRNA(LYS) == Reaction(s)...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS-tRNAs LYS-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
 +
* smiles:
 +
** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 961.807   
 +
* inchi key:
 +
** InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
 
* common name:
 
* common name:
** a tRNAlys
+
** 7-hydroxylauroyl-CoA
 
* Synonym(s):
 
* Synonym(s):
** TRNA(LYS)
+
** 7-hydroxydodecanoyl-CoA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LYSINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNAlys}}
+
* PUBCHEM:
{{#set: common name=TRNA(LYS)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819849 91819849]
{{#set: consumed by=LYSINE--TRNA-LIGASE-RXN}}
+
{{#set: smiles=CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: molecular weight=961.807    }}
 +
{{#set: inchi key=InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J}}
 +
{{#set: common name=7-hydroxylauroyl-CoA}}
 +
{{#set: common name=7-hydroxydodecanoyl-CoA}}
 +
{{#set: produced by=RXN-12184}}

Latest revision as of 16:24, 9 January 2019

Metabolite CPD-17638

  • smiles:
    • CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 961.807
  • inchi key:
    • InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
  • common name:
    • 7-hydroxylauroyl-CoA
  • Synonym(s):
    • 7-hydroxydodecanoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.