Difference between revisions of "CPD-14594"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxyglutaryl-ACP-methyl-ester 3-Hydroxyglutaryl-ACP-methyl-ester] == * common name: ** a (...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxyglutaryl-ACP-methyl-ester 3-Hydroxyglutaryl-ACP-methyl-ester] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
 +
* smiles:
 +
** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
 +
* molecular weight:
 +
** 409.389   
 +
* inchi key:
 +
** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
 
* common name:
 
* common name:
** a (3R)-3-hydroxyglutaryl-[acp] methyl ester
+
** linustatin
 
* Synonym(s):
 
* Synonym(s):
 +
** propanenitrile
 +
** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11476]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a (3R)-3-hydroxyglutaryl-[acp] methyl ester}}
+
* CHEBI:
{{#set: produced by=RXN-11476}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333]
 +
{{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
 +
{{#set: molecular weight=409.389    }}
 +
{{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}}
 +
{{#set: common name=linustatin}}
 +
{{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}}
 +
{{#set: consumed by=RXN-13602}}

Latest revision as of 18:52, 9 January 2019

Metabolite CPD-14594

  • smiles:
    • CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • molecular weight:
    • 409.389
  • inchi key:
    • InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
  • common name:
    • linustatin
  • Synonym(s):
    • propanenitrile
    • [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links