Difference between revisions of "CHC T00009352001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23))) * inc...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009352001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DIAMINOPIMDECARB-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | == | + | ** Source: [[orthology-arabidopsis_thaliana]] |
+ | == Pathways associated == | ||
+ | * [[PWY-2942]] | ||
+ | * [[DAPLYSINESYN-PWY]] | ||
+ | * [[PWY-2941]] | ||
+ | * [[PWY-5097]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=DIAMINOPIMDECARB-RXN}} | |
− | + | {{#set: pathway associated=PWY-2942|DAPLYSINESYN-PWY|PWY-2941|PWY-5097}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 17:46, 9 January 2019
Gene CHC_T00009352001_1
- Synonym(s):
Reactions associated
- Reaction: DIAMINOPIMDECARB-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana