Difference between revisions of "CPD-11444"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7836 CPD-7836] == * smiles: ** CCCCCCCCCCCCCC([O-])=O * common name: ** myristate * inchi k...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5)) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 828.742 |
+ | * inchi key: | ||
+ | ** InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F | ||
+ | * common name: | ||
+ | ** uroporphyrinogen-I | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** uroporphyrinogen I |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-10642]] | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62626 62626] |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201940 25201940] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05766 C05766] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.389644.html 389644] |
− | * | + | * HMDB : HMDB02211 |
− | + | {{#set: smiles=C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))}} | |
− | + | {{#set: molecular weight=828.742 }} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F}} |
− | {{#set: | + | {{#set: common name=uroporphyrinogen-I}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=uroporphyrinogen I}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-10642}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 18:54, 9 January 2019
Contents
Metabolite CPD-11444
- smiles:
- C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
- molecular weight:
- 828.742
- inchi key:
- InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
- common name:
- uroporphyrinogen-I
- Synonym(s):
- uroporphyrinogen I
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))" cannot be used as a page name in this wiki.