Difference between revisions of "Mitogen-Activated-Protein-Kinase-L-Thr"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8848 CPD-8848] == * smiles: ** C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O * common name: ** (E,E)-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitogen-Activated-Protein-Kinase-L-Thr Mitogen-Activated-Protein-Kinase-L-Thr] == * common name...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitogen-Activated-Protein-Kinase-L-Thr Mitogen-Activated-Protein-Kinase-L-Thr] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [mitogen-activated protein kinase]-L-threonine |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.7.12.2-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [mitogen-activated protein kinase]-L-threonine}} | |
− | + | {{#set: reversible reaction associated=2.7.12.2-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 15:06, 23 May 2018
Contents
Metabolite Mitogen-Activated-Protein-Kinase-L-Thr
- common name:
- a [mitogen-activated protein kinase]-L-threonine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [mitogen-activated protein kinase]-L-threonine" cannot be used as a page name in this wiki.