Difference between revisions of "CPD-535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dipeptides-With-Proline-Carboxy Dipeptides-With-Proline-Carboxy] == * common name: ** a dipepti...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dipeptides-With-Proline-Carboxy Dipeptides-With-Proline-Carboxy] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] ==
 +
* smiles:
 +
** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-]
 +
* molecular weight:
 +
** 336.085   
 +
* inchi key:
 +
** InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J
 
* common name:
 
* common name:
** a dipeptide with proline at the C-terminal
+
** β-D-fructose 2,6-bisphosphate
 
* Synonym(s):
 
* Synonym(s):
** Xaa-Pro
+
** fru 2,6-P2
** a dipeptide with proline at carboxy terminal
+
** fructose 2,6-diphosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.13.9-RXN]]
+
* [[3.1.3.46-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a dipeptide with proline at the C-terminal}}
+
* METABOLIGHTS : MTBLC58579
{{#set: common name=Xaa-Pro|a dipeptide with proline at carboxy terminal}}
+
* LIGAND-CPD:
{{#set: consumed by=3.4.13.9-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00665 C00665]
 +
* HMDB : HMDB01047
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.19975981.html 19975981]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58579 58579]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21117974 21117974]
 +
{{#set: smiles=C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-]}}
 +
{{#set: molecular weight=336.085    }}
 +
{{#set: inchi key=InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J}}
 +
{{#set: common name=β-D-fructose 2,6-bisphosphate}}
 +
{{#set: common name=fru 2,6-P2|fructose 2,6-diphosphate}}
 +
{{#set: consumed by=3.1.3.46-RXN}}
 +
{{#set: produced by=6-PHOSPHOFRUCTO-2-KINASE-RXN}}

Latest revision as of 18:54, 9 January 2019

Metabolite CPD-535

  • smiles:
    • C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-]
  • molecular weight:
    • 336.085
  • inchi key:
    • InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J
  • common name:
    • β-D-fructose 2,6-bisphosphate
  • Synonym(s):
    • fru 2,6-P2
    • fructose 2,6-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-" cannot be used as a page name in this wiki.