Difference between revisions of "DMPBQ"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-665 CPD-665] == * smiles: ** CC[CH]=O * inchi key: ** InChIKey=NBBJYMSMWIIQGU-UHFFFAOYSA-N...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == |
* smiles: | * smiles: | ||
| − | ** CC | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C |
| + | * molecular weight: | ||
| + | ** 416.686 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N |
* common name: | * common name: | ||
| − | ** 1- | + | ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-2542]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75921 75921] | ||
| + | * METABOLIGHTS : MTBLC75921 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768102 71768102] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15883 C15883] |
| − | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C}} | |
| − | + | {{#set: molecular weight=416.686 }} | |
| − | + | {{#set: inchi key=InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N}} | |
| − | + | {{#set: common name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}} | |
| − | + | {{#set: produced by=RXN-2542}} | |
| − | {{#set: smiles=CC | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Latest revision as of 17:55, 9 January 2019
Contents
Metabolite DMPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C
- molecular weight:
- 416.686
- inchi key:
- InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N
- common name:
- 2,3-dimethyl-6-phytyl-1,4-benzoquinol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
