Difference between revisions of "CPD-11528"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15831 RXN-15831] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15831 RXN-15831] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
 +
* molecular weight:
 +
** 997.797   
 +
* inchi key:
 +
** InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J
 +
* common name:
 +
** OPC4-3-ketoacyl-CoA
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10701]]
** 1 [[Oxidized-CycA1-cytochromes]][e] '''+''' 1 [[E-]][c] '''=>''' 1 [[Reduced-CycA1-cytochromes]][e]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-10703]]
**
+
== Reaction(s) of unknown directionality ==
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237346 44237346]
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=997.797    }}
{{#set: reconstruction source=original_genome}}
+
{{#set: inchi key=InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J}}
 +
{{#set: common name=OPC4-3-ketoacyl-CoA}}
 +
{{#set: consumed by=RXN-10701}}
 +
{{#set: produced by=RXN-10703}}

Latest revision as of 17:56, 9 January 2019

Metabolite CPD-11528

  • smiles:
    • CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
  • molecular weight:
    • 997.797
  • inchi key:
    • InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J
  • common name:
    • OPC4-3-ketoacyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.