Difference between revisions of "RXN-17808"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * smiles: ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17808 RXN-17808] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde dehydrogenase, (NA...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17808 RXN-17808] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehyde dehydrogenase, (NAD) activity |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-10793]][c] '''=>''' 1 [[3-P-HYDROXYPYRUVATE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 hydroxypyruvaldehyde phosphate[c] '''=>''' 1 3-phospho-hydroxypyruvate[c] '''+''' 2 H+[c] '''+''' 1 NADH[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00008341001]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=aldehyde dehydrogenase, (NAD) activity}} | |
| − | + | {{#set: ec number=EC-1.2.1.3}} | |
| − | + | {{#set: gene associated=CHC_T00008341001}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-original_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:57, 23 May 2018
Contents
Reaction RXN-17808
- direction:
- LEFT-TO-RIGHT
- common name:
- aldehyde dehydrogenase, (NAD) activity
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 H2O[c] + 1 hydroxypyruvaldehyde phosphate[c] => 1 3-phospho-hydroxypyruvate[c] + 2 H+[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008341001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
