Difference between revisions of "RXN-14570"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] == * smiles: ** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14570 RXN-14570] ==
* smiles:
+
* direction:
** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M
+
** [http://enzyme.expasy.org/EC/2.3.1.234 EC-2.3.1.234]
* common name:
+
** cyclic pyranopterin phosphate
+
* molecular weight:
+
** 344.2  
+
 
* Synonym(s):
 
* Synonym(s):
** precursor Z
 
** cPMP
 
** precursor-Z
 
** 8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide
 
** 8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide
 
** cyclic pyranopterin monophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-8342]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-15435]][c] '''+''' 1 [[tRNA-adenine-37]][c] '''=>''' 1 [[N6-L-threonylcarbamoyladenine37-tRNAs]][c] '''+''' 1 [[AMP]][c]
* [[RXN-17809]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 L-threonylcarbamoyladenylate[c] '''+''' 1 an adenine37 in tRNA[c] '''=>''' 1 an N6-L-threonylcarbamoyladenine37 in tRNA[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00000321001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY0-1587]], N6-L-threonylcarbamoyladenosine37-modified tRNA biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1587 PWY0-1587]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659039 90659039]
+
{{#set: ec number=EC-2.3.1.234}}
* CHEBI:
+
{{#set: gene associated=CHC_T00000321001_1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59648 59648]
+
{{#set: in pathway=PWY0-1587}}
{{#set: smiles=C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M}}
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus}}
{{#set: common name=cyclic pyranopterin phosphate}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=344.2    }}
+
{{#set: common name=precursor Z|cPMP|precursor-Z|8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide|8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide|cyclic pyranopterin monophosphate}}
+
{{#set: consumed by=RXN-8342}}
+
{{#set: produced by=RXN-17809}}
+

Latest revision as of 17:54, 9 January 2019

Reaction RXN-14570

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1587, N6-L-threonylcarbamoyladenosine37-modified tRNA biosynthesis: PWY0-1587
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links