Difference between revisions of "CPD-7107"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-25 TRANS-RXN1HP7-25] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-25 TRANS-RXN1HP7-25] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C
 +
* molecular weight:
 +
** 331.431   
 +
* inchi key:
 +
** InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M
 
* common name:
 
* common name:
** TRANS-RXN1HP7-25
+
** diprenylphlorisobutyrophenone
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxycohumulone
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1.0 [[WATER]][c] '''+''' 1.0 [[ATP]][c] '''+''' 1.0 [[TAURINE]][e] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[TAURINE]][c]
+
* [[RXN-7813]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1.0 H2O[c] '''+''' 1.0 ATP[c] '''+''' 1.0 taurine[e] '''=>''' 1.0 phosphate[c] '''+''' 1.0 ADP[c] '''+''' 1.0 taurine[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00000780001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=TRANS-RXN1HP7-25}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203729 25203729]
{{#set: gene associated=CHC_T00000780001_1}}
+
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C}}
{{#set: in pathway=}}
+
{{#set: molecular weight=331.431    }}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=diprenylphlorisobutyrophenone}}
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=deoxycohumulone}}
 +
{{#set: produced by=RXN-7813}}

Latest revision as of 17:57, 9 January 2019

Metabolite CPD-7107

  • smiles:
    • CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C
  • molecular weight:
    • 331.431
  • inchi key:
    • InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M
  • common name:
    • diprenylphlorisobutyrophenone
  • Synonym(s):
    • deoxycohumulone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C" cannot be used as a page name in this wiki.