Difference between revisions of "RXN-7651"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * smiles: ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7651 RXN-7651] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7651 RXN-7651] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J
+
** [http://enzyme.expasy.org/EC/1.14.13.21 EC-1.14.13.21]
−
* common name:
+
−
** (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA
+
−
* molecular weight:
+
−
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-14:1-Δ7-CoA
 
−
** (S)-3-hydroxy-7-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17794]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-431]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[5734-TETRAHYDROXYFLAVONE]][c] '''+''' 1 [[NADP]][c]
−
* [[RXN-17793]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 oxygen[c] '''+''' 1 H+[c] '''+''' 1 apigenin[c] '''+''' 1 NADPH[c] '''=>''' 1 H2O[c] '''+''' 1 luteolin[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008813001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00008672001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00009499001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00010004001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00008616001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00010245001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00009131001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00008663001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00009062001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-5060]], luteolin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5060 PWY-5060]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06537 R06537]
−
{{#set: common name=(S)-3-hydroxy-(7Z)-tetradecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=987.845    }}
+
{{#set: ec number=EC-1.14.13.21}}
−
{{#set: common name=(S)-3-hydroxy-14:1-Δ7-CoA|(S)-3-hydroxy-7-cis-tetradecenoyl-CoA}}
+
{{#set: gene associated=CHC_T00008813001_1|CHC_T00008672001_1|CHC_T00009499001_1|CHC_T00010004001_1|CHC_T00008616001_1|CHC_T00010245001_1|CHC_T00009131001_1|CHC_T00008663001_1|CHC_T00009062001_1}}
−
{{#set: consumed by=RXN-17794}}
+
{{#set: in pathway=PWY-5060}}
−
{{#set: produced by=RXN-17793}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-arabidopsis_thaliana}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 15:07, 23 May 2018

Reaction RXN-7651

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5060, luteolin biosynthesis: PWY-5060
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-7651&oldid=13294"