Difference between revisions of "CPD-12936"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5282 RXN-5282] == * direction: ** LEFT-TO-RIGHT * common name: ** Magnesium-protoporphyrin IX m...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5282 RXN-5282] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
 +
* molecular weight:
 +
** 482.748   
 +
* inchi key:
 +
** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
 
* common name:
 
* common name:
** Magnesium-protoporphyrin IX monomethyl ester (oxidative) cyclase
+
** apo-4'-lycopenal
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[MG-PROTOPORPHYRIN-MONOMETHYL-ESTER]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[13-HYDROXY-MAGNESIUM-PROTOPORP]][c]
+
* [[RXN-11999]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 magnesium-protoporphyrin IX 13-monomethyl ester[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 H+[c] '''=>''' 1 H2O[c] '''+''' 1 NADP+[c] '''+''' 1 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_670]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R06265 R06265]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}}
{{#set: common name=Magnesium-protoporphyrin IX monomethyl ester (oxidative) cyclase}}
+
{{#set: molecular weight=482.748    }}
{{#set: gene associated=CHC_670}}
+
{{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}}
{{#set: in pathway=CHLOROPHYLL-SYN|PWY-7159}}
+
{{#set: common name=apo-4'-lycopenal}}
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-11999}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 18:57, 9 January 2019

Metabolite CPD-12936

  • smiles:
    • CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
  • molecular weight:
    • 482.748
  • inchi key:
    • InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
  • common name:
    • apo-4'-lycopenal
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links