Difference between revisions of "CPD-7496"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == |
* smiles: | * smiles: | ||
− | ** CC(= | + | ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C |
+ | * molecular weight: | ||
+ | ** 536.882 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N |
* common name: | * common name: | ||
− | ** | + | ** prolycopene |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7,9,9',7'-tetra-cis-lycopene |
+ | ** 9,9'-di-cis-ζ-carotene | ||
+ | ** 7,9,9',7'-tetracis-lycopene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8042]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11357]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-12242]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62466 62466] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10918539 10918539] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15858 C15858] |
− | {{#set: smiles=CC(= | + | * HMDB : HMDB35776 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C}} |
− | {{#set: common name= | + | {{#set: molecular weight=536.882 }} |
− | + | {{#set: inchi key=InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N}} | |
− | {{#set: common name= | + | {{#set: common name=prolycopene}} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=7,9,9',7'-tetra-cis-lycopene|9,9'-di-cis-ζ-carotene|7,9,9',7'-tetracis-lycopene}} |
+ | {{#set: consumed by=RXN-8042}} | ||
+ | {{#set: produced by=RXN-11357}} | ||
+ | {{#set: reversible reaction associated=RXN-12242}} |
Latest revision as of 18:58, 9 January 2019
Contents
Metabolite CPD-7496
- smiles:
- CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C
- molecular weight:
- 536.882
- inchi key:
- InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N
- common name:
- prolycopene
- Synonym(s):
- 7,9,9',7'-tetra-cis-lycopene
- 9,9'-di-cis-ζ-carotene
- 7,9,9',7'-tetracis-lycopene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links