Difference between revisions of "CPD-4568"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12510 RXN-12510] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12510 RXN-12510] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.14.13.21 EC-1.14.13.21]
+
** 442.724   
 +
* inchi key:
 +
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
 +
* common name:
 +
** 14-hydroxylanosterol
 
* Synonym(s):
 
* Synonym(s):
 +
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-304]]
−
** 1 [[NADPH]][c] '''+''' 1 [[CPD1F-90]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-520]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-303]]
−
** 1 NADPH[c] '''+''' 1 kaempferol[c] '''+''' 1 H+[c] '''+''' 1 oxygen[c] '''=>''' 1 NADP+[c] '''+''' 1 H2O[c] '''+''' 1 quercetin[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009131001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00009062001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00008672001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00010004001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00009499001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00008616001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00010245001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00008663001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00008813001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06538 R06538]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
{{#set: ec number=EC-1.14.13.21}}
+
{{#set: molecular weight=442.724    }}
−
{{#set: gene associated=CHC_T00009131001_1|CHC_T00009062001_1|CHC_T00008672001_1|CHC_T00010004001_1|CHC_T00009499001_1|CHC_T00008616001_1|CHC_T00010245001_1|CHC_T00008663001_1|CHC_T00008813001_1}}
+
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
−
{{#set: in pathway=PWY-3101}}
+
{{#set: common name=14-hydroxylanosterol}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN66-304}}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: produced by=RXN66-303}}

Latest revision as of 17:58, 9 January 2019

Metabolite CPD-4568

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • molecular weight:
    • 442.724
  • inchi key:
    • InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
  • common name:
    • 14-hydroxylanosterol
  • Synonym(s):
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-4568&oldid=23740"