Difference between revisions of "RXN-11474"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11474 RXN-11474] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-glutaryl-[acp] methyl...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11474 RXN-11474] ==
* smiles:
+
* direction:
** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
+
 
* common name:
 
* common name:
** 5-hydroxyferulate
+
** 3-oxo-glutaryl-[acp] methyl ester synthase
* molecular weight:
+
** Beta-ketoacyl synthase
** 209.178   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxy ferulic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-1121]]
+
** 1 [[Malonyl-acp-methyl-ester]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[3-Ketoglutaryl-ACP-methyl-ester]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a malonyl-[acp] methyl ester[c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 a 3-oxo-glutaryl-[acp] methyl ester[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009465001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00009465001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
 +
** '''7''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354]
+
{{#set: common name=3-oxo-glutaryl-[acp] methyl ester synthase}}
* LIGAND-CPD:
+
{{#set: common name=Beta-ketoacyl synthase}}
** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619]
+
{{#set: ec number=EC-2.3.1.41}}
* HMDB : HMDB35484
+
{{#set: gene associated=CHC_T00009465001|CHC_T00009465001_1}}
{{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}}
+
{{#set: in pathway=PWY-6519}}
{{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: common name=5-hydroxyferulate}}
+
{{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus}}
{{#set: molecular weight=209.178    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: common name=5-hydroxy ferulic acid}}
+
{{#set: produced by=RXN-1121}}
+

Latest revision as of 16:58, 23 May 2018

Reaction RXN-11474

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-glutaryl-[acp] methyl ester synthase
    • Beta-ketoacyl synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
    • 7 reactions found over 11 reactions in the full pathway

Reconstruction information

External links

"3-oxo-glutaryl-[acp] methyl ester synthase" cannot be used as a page name in this wiki.