Difference between revisions of "CPD-698"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1108 CPD-1108] == * common name: ** a 1-phosphatidyl-1D-myo-inositol 4-phosphate * Synonym(...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1108 CPD-1108] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
 +
* smiles:
 +
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* molecular weight:
 +
** 398.671   
 +
* inchi key:
 +
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
 
* common name:
 
* common name:
** a 1-phosphatidyl-1D-myo-inositol 4-phosphate
+
** campest-4-en-3-one
 
* Synonym(s):
 
* Synonym(s):
** phosphatidylinositol-4-phosphate
+
** methylcholestenone
** PtdIns4P
+
** (24R)-24-methyl-cholest-4-en-3-one
 +
** 3-dehydro-Δ4-5-campesterol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.68-RXN]]
+
* [[RXN-4231]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
 
* [[PHOSPHATIDYLINOSITOL-BISPHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a 1-phosphatidyl-1D-myo-inositol 4-phosphate}}
+
* PUBCHEM:
{{#set: common name=phosphatidylinositol-4-phosphate|PtdIns4P}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988279 11988279]
{{#set: consumed by=2.7.1.68-RXN}}
+
* LIGAND-CPD:
{{#set: produced by=1-PHOSPHATIDYLINOSITOL-KINASE-RXN|PHOSPHATIDYLINOSITOL-BISPHOSPHATASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
 +
* HMDB : HMDB12196
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
 +
{{#set: common name=campest-4-en-3-one}}
 +
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
 +
{{#set: consumed by=RXN-4231}}

Latest revision as of 18:59, 9 January 2019

Metabolite CPD-698

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • molecular weight:
    • 398.671
  • inchi key:
    • InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
  • common name:
    • campest-4-en-3-one
  • Synonym(s):
    • methylcholestenone
    • (24R)-24-methyl-cholest-4-en-3-one
    • 3-dehydro-Δ4-5-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.