Difference between revisions of "CPD-7146"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7146 CPD-7146] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(CC1(OC(C=C(C=1)[O-])=O))C |
+ | * molecular weight: | ||
+ | ** 167.184 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 6-isobutyl-4-hydroxy-2-pyrone |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-7825]] | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203460 25203460] |
− | + | {{#set: smiles=CC(CC1(OC(C=C(C=1)[O-])=O))C}} | |
− | + | {{#set: molecular weight=167.184 }} | |
− | + | {{#set: inchi key=InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M}} | |
− | + | {{#set: common name=6-isobutyl-4-hydroxy-2-pyrone}} | |
− | + | {{#set: reversible reaction associated=RXN-7825}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:01, 9 January 2019
Contents
Metabolite CPD-7146
- smiles:
- CC(CC1(OC(C=C(C=1)[O-])=O))C
- molecular weight:
- 167.184
- inchi key:
- InChIKey=DFYHDDCNKMPXMX-UHFFFAOYSA-M
- common name:
- 6-isobutyl-4-hydroxy-2-pyrone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(CC1(OC(C=C(C=1)[O-])=O))C" cannot be used as a page name in this wiki.