Difference between revisions of "CPD-4580"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5-DEHYDROGENASE-RXN SHIKIMATE-5-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5-DEHYDROGENASE-RXN SHIKIMATE-5-DEHYDROGENASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4580 CPD-4580] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C([CH]=O)C(O)CCC(C)1C=2CCC(C)34))))
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.25 EC-1.1.1.25]
+
** 412.654   
 +
* inchi key:
 +
** InChIKey=ZLQSSFNCEUGGJF-NUESBDPTSA-N
 +
* common name:
 +
** 4α-formyl-5α-cholesta-8,24-dien-3β-ol
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-317]]
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-DEHYDRO-SHIKIMATE]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[SHIKIMATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-316]]
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 3-dehydroshikimate[c] '''=>''' 1 NADP+[c] '''+''' 1 shikimate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00007254001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
*** [[a.taliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17737 17737]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298941 22298941]
−
* LIGAND-RXN:
+
* HMDB : HMDB01203
−
** [http://www.genome.jp/dbget-bin/www_bget?R02413 R02413]
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C([CH]=O)C(O)CCC(C)1C=2CCC(C)34))))}}
−
* UNIPROT:
+
{{#set: molecular weight=412.654    }}
−
** [http://www.uniprot.org/uniprot/P07547 P07547]
+
{{#set: inchi key=InChIKey=ZLQSSFNCEUGGJF-NUESBDPTSA-N}}
−
** [http://www.uniprot.org/uniprot/P08566 P08566]
+
{{#set: common name=4α-formyl-5α-cholesta-8,24-dien-3β-ol}}
−
** [http://www.uniprot.org/uniprot/Q58484 Q58484]
+
{{#set: consumed by=RXN66-317}}
−
** [http://www.uniprot.org/uniprot/Q9PIA0 Q9PIA0]
+
{{#set: produced by=RXN66-316}}
−
** [http://www.uniprot.org/uniprot/P0A6D5 P0A6D5]
+
−
** [http://www.uniprot.org/uniprot/Q9CES7 Q9CES7]
+
−
** [http://www.uniprot.org/uniprot/Q44606 Q44606]
+
−
** [http://www.uniprot.org/uniprot/Q44608 Q44608]
+
−
** [http://www.uniprot.org/uniprot/Q44609 Q44609]
+
−
** [http://www.uniprot.org/uniprot/Q44610 Q44610]
+
−
** [http://www.uniprot.org/uniprot/Q44611 Q44611]
+
−
** [http://www.uniprot.org/uniprot/Q44612 Q44612]
+
−
** [http://www.uniprot.org/uniprot/P15770 P15770]
+
−
** [http://www.uniprot.org/uniprot/Q42947 Q42947]
+
−
** [http://www.uniprot.org/uniprot/O65917 O65917]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-1.1.1.25}}
+
−
{{#set: gene associated=CHC_T00007254001_1}}
+
−
{{#set: in pathway=PWY-6163}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 18:02, 9 January 2019

Metabolite CPD-4580

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C([CH]=O)C(O)CCC(C)1C=2CCC(C)34))))
  • molecular weight:
    • 412.654
  • inchi key:
    • InChIKey=ZLQSSFNCEUGGJF-NUESBDPTSA-N
  • common name:
    • 4α-formyl-5α-cholesta-8,24-dien-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C([CH]=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-4580&oldid=23811"