Difference between revisions of "CHC T00004666001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...") |
(Created page with "Category:Gene == Gene CHC_T00004666001_1 == * Synonym(s): == Reactions associated == * Reaction: TRANS-RXN1HP7-45 ** Source: orthology-galdieria.sulphuraria * Rea...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00004666001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[TRANS-RXN1HP7-45]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | + | * Reaction: [[TRANS-RXN1HP7-46]] | |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=TRANS-RXN1HP7-45|TRANS-RXN1HP7-46}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 18:01, 23 May 2018
Gene CHC_T00004666001_1
- Synonym(s):
Reactions associated
- Reaction: TRANS-RXN1HP7-45
- Source: orthology-galdieria.sulphuraria
- Reaction: TRANS-RXN1HP7-46
- Source: orthology-galdieria.sulphuraria