Difference between revisions of "CPD-12852"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE] == * smiles: ** C(NC=O)C(=O)...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
+ | * molecular weight: | ||
+ | ** 412.698 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N |
* common name: | * common name: | ||
− | ** | + | ** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** 5 | + | ** 5α-cholesta-8,24-dien-3β-ol |
− | + | ** 4α,14α-dimethylzymosterol | |
− | ** | + | ** 29-norlanosterol |
− | ** | + | |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11881]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557] |
− | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | |
− | + | {{#set: molecular weight=412.698 }} | |
− | + | {{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}} | |
− | + | {{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}} | |
− | + | {{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}} | |
− | + | {{#set: consumed by=RXN-11881}} | |
− | {{#set: smiles=C( | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name=5 | + | |
− | {{#set: consumed by= | + | |
− | + | ||
− | + |
Latest revision as of 18:02, 9 January 2019
Contents
Metabolite CPD-12852
- smiles:
- CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 412.698
- inchi key:
- InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
- common name:
- 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
- Synonym(s):
- 5α-cholesta-8,24-dien-3β-ol
- 4α,14α-dimethylzymosterol
- 29-norlanosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.