Difference between revisions of "CHC T00008746001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * smiles: ** C1(NC2(=C(N=1)N=CNC(=O)2)) * inchi key: ** InChIKey=...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008746001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[5.1.1.16-RXN]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | + | * Reaction: [[5.1.1.18-RXN]] | |
− | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
+ | * Reaction: [[RXN0-2381]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN0-2382]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[TRYPSYN-RXN]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6196]] | ||
+ | * [[TRPSYN-PWY]] | ||
+ | * [[PWY-6949]] | ||
+ | * [[PWY-6455]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=5.1.1.16-RXN|5.1.1.18-RXN|RXN0-2381|RXN0-2382|TRYPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6196|TRPSYN-PWY|PWY-6949|PWY-6455}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 17:57, 9 January 2019
Gene CHC_T00008746001_1
- Synonym(s):
Reactions associated
- Reaction: 5.1.1.16-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: 5.1.1.18-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN0-2381
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN0-2382
- Source: orthology-ectocarpus_siliculosus
- Reaction: TRYPSYN-RXN
- Source: orthology-ectocarpus_siliculosus