Difference between revisions of "ACYLPHOSPHATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * inchi key: **...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACYLPHOSPHATASE-RXN ACYLPHOSPHATASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.7 EC-3.6.1.7] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[Acyl-Phosphates]][c] '''=>''' 1 [[Carboxylates]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 an acyl phosphate[c] '''=>''' 1 a carboxylate[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00007234001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14965 14965] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P14620 P14620] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P35745 P35745] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P41500 P41500] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CHW2 Q9CHW2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0AB65 P0AB65] |
+ | ** [http://www.uniprot.org/uniprot/P07033 P07033] | ||
+ | ** [http://www.uniprot.org/uniprot/P07031 P07031] | ||
+ | ** [http://www.uniprot.org/uniprot/P07032 P07032] | ||
+ | ** [http://www.uniprot.org/uniprot/P35744 P35744] | ||
+ | ** [http://www.uniprot.org/uniprot/P00818 P00818] | ||
+ | ** [http://www.uniprot.org/uniprot/P07311 P07311] | ||
+ | ** [http://www.uniprot.org/uniprot/P00819 P00819] | ||
+ | ** [http://www.uniprot.org/uniprot/P00820 P00820] | ||
+ | ** [http://www.uniprot.org/uniprot/P00821 P00821] | ||
+ | ** [http://www.uniprot.org/uniprot/P14621 P14621] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R00539 R00539] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-3.6.1.7}} | ||
+ | {{#set: gene associated=CHC_T00007234001_1}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 18:01, 9 January 2019
Contents
Reaction ACYLPHOSPHATASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Acyl-Phosphates[c] => 1 Carboxylates[c] + 1 Pi[c] + 1 PROTON[c]
- With common name(s):
- 1 H2O[c] + 1 an acyl phosphate[c] => 1 a carboxylate[c] + 1 phosphate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00007234001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links
- RHEA:
- UNIPROT:
- LIGAND-RXN: