Difference between revisions of "DCTP"
From metabolic_network
(Created page with "{{#ask: Category:Reaction | ?common name | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source | ?gene associated | ?in pathway }}") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | + | [[Category:Metabolite]] | |
− | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == | |
− | + | * smiles: | |
− | + | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | |
− | + | * molecular weight: | |
− | + | ** 463.127 | |
− | | | + | * inchi key: |
− | | | + | ** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J |
− | }} | + | * common name: |
+ | ** dCTP | ||
+ | * Synonym(s): | ||
+ | ** 2'-deoxycytidine-5'-triphosphate | ||
+ | ** deoxycytidine-triphosphate | ||
+ | ** deoxy-CTP | ||
+ | |||
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[DCTP-PYROPHOSPHATASE-RXN]] | ||
+ | * [[RXN-14216]] | ||
+ | * [[RXN-14198]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[DCDPKIN-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | == External links == | ||
+ | * BIGG : dctp | ||
+ | * CAS : 2056-98-6 | ||
+ | * HMDB : HMDB00998 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] | ||
+ | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
+ | {{#set: molecular weight=463.127 }} | ||
+ | {{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} | ||
+ | {{#set: common name=dCTP}} | ||
+ | {{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} | ||
+ | {{#set: consumed by=DCTP-PYROPHOSPHATASE-RXN|RXN-14216|RXN-14198}} | ||
+ | {{#set: produced by=DCDPKIN-RXN}} |
Latest revision as of 18:05, 9 January 2019
Contents
Metabolite DCTP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- molecular weight:
- 463.127
- inchi key:
- InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
- common name:
- dCTP
- Synonym(s):
- 2'-deoxycytidine-5'-triphosphate
- deoxycytidine-triphosphate
- deoxy-CTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.