Difference between revisions of "TAURINE"
From metabolic_network
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAURINE TAURINE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(S(=O)(=O)[O-])C[N+] |
+ | * molecular weight: | ||
+ | ** 125.142 | ||
+ | * inchi key: | ||
+ | ** InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** taurine |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-aminoethanesulfonate | ||
+ | ** tauphon | ||
+ | ** taufon | ||
+ | ** 2-aminoethanesulfonic acid | ||
+ | ** aminoetylsulphonic acid | ||
+ | ** ethylaminesulphonic acid | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[TRANS-RXN1HP7-25]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[TRANS-RXN1HP7-25]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | * | + | * METABOLIGHTS : MTBLC507393 |
− | ** [http:// | + | * BIGG : taur |
− | {{#set: | + | * CAS : 107-35-7 |
− | {{#set: common name= | + | * HMDB : HMDB00251 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=507393 507393] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00245 C00245] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4068592 4068592] | ||
+ | {{#set: smiles=C(S(=O)(=O)[O-])C[N+]}} | ||
+ | {{#set: molecular weight=125.142 }} | ||
+ | {{#set: inchi key=InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=taurine}} | ||
+ | {{#set: common name=2-aminoethanesulfonate|tauphon|taufon|2-aminoethanesulfonic acid|aminoetylsulphonic acid|ethylaminesulphonic acid}} | ||
+ | {{#set: consumed by=TRANS-RXN1HP7-25}} | ||
+ | {{#set: produced by=TRANS-RXN1HP7-25}} |
Latest revision as of 15:56, 9 January 2019
Contents
Metabolite TAURINE
- smiles:
- C(S(=O)(=O)[O-])C[N+]
- molecular weight:
- 125.142
- inchi key:
- InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N
- common name:
- taurine
- Synonym(s):
- 2-aminoethanesulfonate
- tauphon
- taufon
- 2-aminoethanesulfonic acid
- aminoetylsulphonic acid
- ethylaminesulphonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC507393
- BIGG : taur
- CAS : 107-35-7
- HMDB : HMDB00251
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(S(=O)(=O)[O-])C[N+" cannot be used as a page name in this wiki.