Difference between revisions of "CPD-19157"
From metabolic_network
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * molecular weight: | ||
| + | ** 985.829 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo-(7Z)-tetradecenoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-14:1-Δ7-CoA | ||
| + | ** 3-oxo-7-cis-tetradecenoyl-CoA | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-17795]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) | + | * [[RXN-17794]] |
| − | * [ | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: common name= | + | {{#set: molecular weight=985.829 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}} |
| − | {{#set: | + | {{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}} |
| − | {{#set: | + | {{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}} |
| + | {{#set: consumed by=RXN-17795}} | ||
| + | {{#set: produced by=RXN-17794}} | ||
Latest revision as of 14:57, 9 January 2019
Contents
Metabolite CPD-19157
- smiles:
- CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 985.829
- inchi key:
- InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
- common name:
- 3-oxo-(7Z)-tetradecenoyl-CoA
- Synonym(s):
- 3-oxo-14:1-Δ7-CoA
- 3-oxo-7-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
