Difference between revisions of "CPD-4618"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TAX-6656]
+
** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* molecular weight:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** 381.388   
 +
* inchi key:
 +
** InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N
 
* common name:
 
* common name:
** trehalose biosynthesis I
+
** cis-zeatin-7-N-glucoside
 
* Synonym(s):
 
* Synonym(s):
** trehalose biosynthesis
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[TREHALOSE6PSYN-RXN]]
+
* [[RXN-4733]]
* [[TREHALOSEPHOSPHA-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* PUBCHEM:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244153 25244153]
{{#set: taxonomic range=TAX-6656}}
+
* HMDB : HMDB12201
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO}}
{{#set: taxonomic range=TAX-4751}}
+
{{#set: molecular weight=381.388    }}
{{#set: common name=trehalose biosynthesis I}}
+
{{#set: inchi key=InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N}}
{{#set: common name=trehalose biosynthesis}}
+
{{#set: common name=cis-zeatin-7-N-glucoside}}
{{#set: reaction found=2}}
+
{{#set: produced by=RXN-4733}}
{{#set: reaction not found=2}}
+
{{#set: completion rate=100.0}}
+

Latest revision as of 16:08, 9 January 2019

Metabolite CPD-4618

  • smiles:
    • CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO
  • molecular weight:
    • 381.388
  • inchi key:
    • InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N
  • common name:
    • cis-zeatin-7-N-glucoside
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links