Difference between revisions of "CPD-8678"
From metabolic_network
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO |
+ | * molecular weight: | ||
+ | ** 309.425 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 9(S)-HPOTE |
* Synonym(s): | * Synonym(s): | ||
+ | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid | ||
+ | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[RXN-8497]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321] |
− | {{#set: | + | {{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}} |
+ | {{#set: molecular weight=309.425 }} | ||
+ | {{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}} | ||
+ | {{#set: common name=9(S)-HPOTE}} | ||
+ | {{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}} | ||
+ | {{#set: produced by=RXN-8497}} |
Latest revision as of 16:20, 9 January 2019
Contents
Metabolite CPD-8678
- smiles:
- CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
- molecular weight:
- 309.425
- inchi key:
- InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
- common name:
- 9(S)-HPOTE
- Synonym(s):
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.