Difference between revisions of "PYRROLINE-HYDROXY-CARBOXYLATE"
From metabolic_network
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C1(=NC(C([O-])=O)CC(O)1) |
− | ** | + | * molecular weight: |
+ | ** 128.107 | ||
+ | * inchi key: | ||
+ | ** InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** (3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-Δ1-pyrroline 3-hydroxy-5-carboxylate |
+ | ** L-1pyrroline-3-hydroxy-5-carboxylate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-546]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62612 62612] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926300 46926300] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04281 C04281] |
− | {{#set: | + | * HMDB : HMDB01369 |
+ | {{#set: smiles=C1(=NC(C([O-])=O)CC(O)1)}} | ||
+ | {{#set: molecular weight=128.107 }} | ||
+ | {{#set: inchi key=InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M}} | ||
+ | {{#set: common name=(3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate}} | ||
+ | {{#set: common name=L-Δ1-pyrroline 3-hydroxy-5-carboxylate|L-1pyrroline-3-hydroxy-5-carboxylate}} | ||
+ | {{#set: consumed by=RXN66-546}} |
Latest revision as of 15:38, 9 January 2019
Contents
Metabolite PYRROLINE-HYDROXY-CARBOXYLATE
- smiles:
- C1(=NC(C([O-])=O)CC(O)1)
- molecular weight:
- 128.107
- inchi key:
- InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M
- common name:
- (3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate
- Synonym(s):
- L-Δ1-pyrroline 3-hydroxy-5-carboxylate
- L-1pyrroline-3-hydroxy-5-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=NC(C([O-])=O)CC(O)1)" cannot be used as a page name in this wiki.