Difference between revisions of "CPD-15651"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5782 TAX-5782]
+
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-10239 TAX-10239]
+
* molecular weight:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** 957.819   
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
* inchi key:
 +
** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
 
* common name:
 
* common name:
** pyrimidine deoxyribonucleotides de novo biosynthesis III
+
** 6-trans-tridecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 6E-tridecenoyl-CoA
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''8''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-14785]]
* [[CDPREDUCT-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[DCDPKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[DTDPKIN-RXN]]
+
* [[DTMPKI-RXN]]
+
* [[DUDPKIN-RXN]]
+
* [[DUTP-PYROP-RXN]]
+
* [[RXN-12195]]
+
* [[UDPREDUCT-RXN]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8850 RXN-8850]
+
 
== External links  ==
 
== External links  ==
* LIGAND-MAP:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?map00240 map00240]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572]
{{#set: taxonomic range=TAX-5782}}
+
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: taxonomic range=TAX-10239}}
+
{{#set: molecular weight=957.819    }}
{{#set: taxonomic range=TAX-2}}
+
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}}
{{#set: taxonomic range=TAX-2157}}
+
{{#set: common name=6-trans-tridecenoyl-CoA}}
{{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis III}}
+
{{#set: common name=6E-tridecenoyl-CoA}}
{{#set: reaction found=8}}
+
{{#set: consumed by=RXN-14785}}
{{#set: reaction not found=9}}
+
{{#set: completion rate=89.0}}
+

Latest revision as of 16:38, 9 January 2019

Metabolite CPD-15651

  • smiles:
    • CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 957.819
  • inchi key:
    • InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
  • common name:
    • 6-trans-tridecenoyl-CoA
  • Synonym(s):
    • 6E-tridecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.