Difference between revisions of "PWY0-1301"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1301 PWY0-1301] ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
+
* inchi key:
+
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
+
 
* common name:
 
* common name:
** quinoxaline-2-carboxyl adenylate
+
** melibiose degradation
* molecular weight:
+
* taxonomic range:
** 502.359   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17155]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ALPHAGALACTOSID-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[CHC_T00008497001_1]]
 +
*** [[CHC_T00008413001]]
 +
*** [[CHC_T00008780001_1]]
 +
*** [[CHC_T00008413001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1301 PWY0-1301]
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
+
{{#set: common name=melibiose degradation}}
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
+
{{#set: taxonomic range=TAX-2759}}
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=502.359    }}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: consumed by=RXN-17155}}
+
{{#set: reaction found=1}}
 +
{{#set: total reaction=1}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 15:25, 9 January 2019

Pathway PWY0-1301

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links