Difference between revisions of "CPD-201"
From metabolic_network
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
| + | * molecular weight: | ||
| + | ** 883.61 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxybenzoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** p-hydroxybenzoyl-CoA |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN-11246]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57356 57356] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266585 45266585] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02949 C02949] |
| + | * HMDB : HMDB06467 | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: molecular weight=883.61 }} | ||
| + | {{#set: inchi key=InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J}} | ||
| + | {{#set: common name=4-hydroxybenzoyl-CoA}} | ||
| + | {{#set: common name=p-hydroxybenzoyl-CoA}} | ||
| + | {{#set: produced by=RXN-11246}} | ||
Latest revision as of 16:49, 9 January 2019
Contents
Metabolite CPD-201
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- molecular weight:
- 883.61
- inchi key:
- InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
- common name:
- 4-hydroxybenzoyl-CoA
- Synonym(s):
- p-hydroxybenzoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
