Difference between revisions of "NIACINE"
From metabolic_network
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINE NIACINE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C1(=CC=C(C([O-])=O)C=N1) |
+ | * molecular weight: | ||
+ | ** 122.103 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** nicotinate |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-pyridinecarboxylic acid | ||
+ | ** nicotinic acid | ||
+ | ** wampocap | ||
+ | ** nicolar | ||
+ | ** nicocap | ||
+ | ** nicobid | ||
+ | ** nico-400- | ||
+ | ** nicamin | ||
+ | ** niacin | ||
+ | ** niacine | ||
+ | ** vitamin B3 | ||
+ | ** 3-pyridinecarboxylate | ||
+ | ** pyridine-3-carboxylate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[NICOTINATEPRIBOSYLTRANS-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[NICOTINAMID-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * METABOLIGHTS : MTBLC32544 |
− | {{#set: | + | * BIGG : nac |
− | {{#set: | + | * CAS : 59-67-6 |
− | {{#set: | + | * HMDB : HMDB01488 |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.912.html 912] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32544 32544] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00253 C00253] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=937 937] | ||
+ | {{#set: smiles=C1(=CC=C(C([O-])=O)C=N1)}} | ||
+ | {{#set: molecular weight=122.103 }} | ||
+ | {{#set: inchi key=InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=nicotinate}} | ||
+ | {{#set: common name=3-pyridinecarboxylic acid|nicotinic acid|wampocap|nicolar|nicocap|nicobid|nico-400-|nicamin|niacin|niacine|vitamin B3|3-pyridinecarboxylate|pyridine-3-carboxylate}} | ||
+ | {{#set: consumed by=NICOTINATEPRIBOSYLTRANS-RXN}} | ||
+ | {{#set: produced by=NICOTINAMID-RXN}} |
Latest revision as of 15:50, 9 January 2019
Contents
Metabolite NIACINE
- smiles:
- C1(=CC=C(C([O-])=O)C=N1)
- molecular weight:
- 122.103
- inchi key:
- InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M
- common name:
- nicotinate
- Synonym(s):
- 3-pyridinecarboxylic acid
- nicotinic acid
- wampocap
- nicolar
- nicocap
- nicobid
- nico-400-
- nicamin
- niacin
- niacine
- vitamin B3
- 3-pyridinecarboxylate
- pyridine-3-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC32544
- BIGG : nac
- CAS : 59-67-6
- HMDB : HMDB01488
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C1(=CC=C(C([O-])=O)C=N1)" cannot be used as a page name in this wiki.