Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00001053001_1 == * Synonym(s): == Reactions associated == * CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN ** pantograph-a.taliana == Pathway...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == |
+ | * smiles: | ||
+ | ** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1) | ||
+ | * molecular weight: | ||
+ | ** 414.049 | ||
+ | * inchi key: | ||
+ | ** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H | ||
+ | * common name: | ||
+ | ** D-myo-inositol (1,3,4)-trisphosphate | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Ins(1,3,4)P3 | ||
+ | ** 1-D-myo-inositol (1,3,4)-trisphosphate | ||
+ | ** inositol 1,3,4-trisphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2.7.1.139-RXN]] |
− | + | * [[2.7.1.133-RXN]] | |
− | + | * [[RXN-10939]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[RXN-8730]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414] |
+ | * METABOLIGHTS : MTBLC58414 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01243 C01243] | ||
+ | * HMDB : HMDB01143 | ||
+ | {{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}} | ||
+ | {{#set: molecular weight=414.049 }} | ||
+ | {{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}} | ||
+ | {{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}} | ||
+ | {{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}} | ||
+ | {{#set: consumed by=2.7.1.139-RXN|2.7.1.133-RXN|RXN-10939}} | ||
+ | {{#set: produced by=RXN-8730}} |
Latest revision as of 15:28, 9 January 2019
Contents
Metabolite INOSITOL-1-3-4-TRIPHOSPHATE
- smiles:
- C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
- molecular weight:
- 414.049
- inchi key:
- InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H
- common name:
- D-myo-inositol (1,3,4)-trisphosphate
- Synonym(s):
- Ins(1,3,4)P3
- 1-D-myo-inositol (1,3,4)-trisphosphate
- inositol 1,3,4-trisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.