Difference between revisions of "CPD-712"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7227 PWY-7227] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
* molecular weight:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** 418.702   
 +
* inchi key:
 +
** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
 
* common name:
 
* common name:
** adenosine deoxyribonucleotides de novo biosynthesis
+
** 6-deoxocathasterone
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxocathasterone
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ADPREDUCT-RXN]]
+
* [[RXN-773]]
* [[DADPKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* CHEBI:
{{#set: taxonomic range=TAX-2157}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714]
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=adenosine deoxyribonucleotides de novo biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061344 16061344]
{{#set: reaction found=2}}
+
* LIGAND-CPD:
{{#set: reaction not found=2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798]
{{#set: completion rate=100.0}}
+
* LIPID_MAPS : LMST01030124
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: molecular weight=418.702    }}
 +
{{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}}
 +
{{#set: common name=6-deoxocathasterone}}
 +
{{#set: common name=deoxocathasterone}}
 +
{{#set: produced by=RXN-773}}

Latest revision as of 16:02, 9 January 2019

Metabolite CPD-712

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • molecular weight:
    • 418.702
  • inchi key:
    • InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
  • common name:
    • 6-deoxocathasterone
  • Synonym(s):
    • deoxocathasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.