Difference between revisions of "CPD-8619"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
* molecular weight:
 +
** 429.662   
 +
* inchi key:
 +
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
 
* common name:
 
* common name:
** γ-glutamyl cycle
+
** 4α-carboxy-5α-cholesta-8-en-3β-ol
 
* Synonym(s):
 
* Synonym(s):
** glutathione metabolism
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''4''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN66-23]]
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[GLUTATHIONESYN-PWY]]
+
* [[RXN-13710]]
* [[RXN-6601]]
+
* [[RXN66-22]]
* [[RXN-6622]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33208}}
+
* CHEBI:
{{#set: taxonomic range=TAX-4751}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055]
{{#set: common name=γ-glutamyl cycle}}
+
* PUBCHEM:
{{#set: common name=glutathione metabolism}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593]
{{#set: reaction found=4}}
+
* HMDB : HMDB12166
{{#set: reaction not found=6}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
{{#set: completion rate=67.0}}
+
{{#set: molecular weight=429.662    }}
 +
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
 +
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
 +
{{#set: consumed by=RXN66-23}}
 +
{{#set: produced by=RXN-13710|RXN66-22}}

Latest revision as of 16:04, 9 January 2019

Metabolite CPD-8619

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
  • molecular weight:
    • 429.662
  • inchi key:
    • InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8-en-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.