Difference between revisions of "CPD0-1414"
From metabolic_network
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4)) |
| + | * molecular weight: | ||
| + | ** 444.44 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** tetracycline |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[TRANS-RXN1HP7-17]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[TRANS-RXN1HP7-17]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71392 71392] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=27885548 27885548] |
| − | {{#set: | + | {{#set: smiles=CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))}} |
| + | {{#set: molecular weight=444.44 }} | ||
| + | {{#set: inchi key=InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N}} | ||
| + | {{#set: common name=tetracycline}} | ||
| + | {{#set: consumed by=TRANS-RXN1HP7-17}} | ||
| + | {{#set: produced by=TRANS-RXN1HP7-17}} | ||
Latest revision as of 17:06, 9 January 2019
Contents
Metabolite CPD0-1414
- smiles:
- CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))
- molecular weight:
- 444.44
- inchi key:
- InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N
- common name:
- tetracycline
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))" cannot be used as a page name in this wiki.
