Difference between revisions of "CPD-7695"
From metabolic_network
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7695 CPD-7695] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C |
− | + | * molecular weight: | |
− | ** | + | ** 1873.228 |
+ | * inchi key: | ||
+ | ** InChIKey=ULXTYUPMJXVUHQ-OVTFQNCVSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetyl-β-D-glucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine |
* Synonym(s): | * Synonym(s): | ||
+ | ** lipid II | ||
+ | ** undecaprenyl-pyrophosphoryl-MurNAc-(pentapeptide)-N-acetyl-β-D-glucosamine | ||
+ | ** undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)- | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[RXN-8976]] |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878551 46878551] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05889 C05889] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C}} |
− | {{#set: common name= | + | {{#set: molecular weight=1873.228 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ULXTYUPMJXVUHQ-OVTFQNCVSA-K}} |
− | {{#set: | + | {{#set: common name=ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetyl-β-D-glucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine}} |
− | + | {{#set: common name=lipid II|undecaprenyl-pyrophosphoryl-MurNAc-(pentapeptide)-N-acetyl-β-D-glucosamine|undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-}} | |
+ | {{#set: produced by=RXN-8976}} |
Latest revision as of 16:24, 9 January 2019
Contents
Metabolite CPD-7695
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C
- molecular weight:
- 1873.228
- inchi key:
- InChIKey=ULXTYUPMJXVUHQ-OVTFQNCVSA-K
- common name:
- ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetyl-β-D-glucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine
- Synonym(s):
- lipid II
- undecaprenyl-pyrophosphoryl-MurNAc-(pentapeptide)-N-acetyl-β-D-glucosamine
- undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.
"undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-" cannot be used as a page name in this wiki.