Difference between revisions of "RXN-9634"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9634 RXN-9634] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9634 RXN-9634] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
+
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
* common name:
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
** ω-saturated C55 dolichol phosphate
+
* molecular weight:
+
** 849.311   
+
 
* Synonym(s):
 
* Synonym(s):
** ω-saturated dolichol-11 phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-16602]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[R-3-hydroxystearoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Octadec-2-enoyl-ACPs]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (3R)-3-hydroxystearoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a trans-octadec-2-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY3O-355]], stearate biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-355 PWY3O-355]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
+
{{#set: ec number=EC-2.3.1.86}}
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
+
{{#set: ec number=EC-4.2.1.59}}
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
+
{{#set: in pathway=PWY-5989|PWY3O-355}}
{{#set: common name=ω-saturated C55 dolichol phosphate}}
+
{{#set: reconstruction category=gap-filling}}
{{#set: molecular weight=849.311    }}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
{{#set: common name=ω-saturated dolichol-11 phosphate}}
+
{{#set: reconstruction tool=meneco}}
{{#set: consumed by=RXN-16602}}
+
{{#set: reconstruction comment=added for gapfilling}}

Latest revision as of 15:08, 23 May 2018

Reaction RXN-9634

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-5989, stearate biosynthesis II (bacteria and plants): PWY-5989
    • 6 reactions found over 6 reactions in the full pathway
  • PWY3O-355, stearate biosynthesis III (fungi): PWY3O-355
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links