Difference between revisions of "CPD-4187"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00000384001_1 == * Synonym(s): == Reactions associated == * PEPTIDYLPROLYL-ISOMERASE-RXN ** pantograph-galdieria.sulphuraria == Pat...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == |
| + | * smiles: | ||
| + | ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4)))) | ||
| + | * molecular weight: | ||
| + | ** 384.644 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N | ||
| + | * common name: | ||
| + | ** 7-dehydrocholesterol | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** cholesta-5,7-dien-3 β-ol | ||
| + | ** cholesta-5,7-dienol | ||
| + | ** 7-dehydro-cholesterol | ||
| + | ** cholesta-5,7-dien-3β-ol | ||
| + | ** provitamin D3 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-323]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[1.14.21.6-RXN]] |
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759] | ||
| + | * CAS : 434-16-2 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439423 439423] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164] | ||
| + | * HMDB : HMDB00032 | ||
| + | {{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}} | ||
| + | {{#set: molecular weight=384.644 }} | ||
| + | {{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}} | ||
| + | {{#set: common name=7-dehydrocholesterol}} | ||
| + | {{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}} | ||
| + | {{#set: consumed by=RXN66-323}} | ||
| + | {{#set: produced by=1.14.21.6-RXN}} | ||
Latest revision as of 15:30, 9 January 2019
Contents
Metabolite CPD-4187
- smiles:
- CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
- molecular weight:
- 384.644
- inchi key:
- InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
- common name:
- 7-dehydrocholesterol
- Synonym(s):
- cholesta-5,7-dien-3 β-ol
- cholesta-5,7-dienol
- 7-dehydro-cholesterol
- cholesta-5,7-dien-3β-ol
- provitamin D3
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.
