Difference between revisions of "PWY-7161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC=C(O)1) * inchi key:...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7161 PWY-7161] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** polymethylated quercetin biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-91827 TAX-91827] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | == Reaction(s) | + | '''1''' reactions found over '''9''' reactions in the full pathway |
| − | * [[RXN- | + | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00007625001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.82-RXN 2.1.1.82-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13906 RXN-13906] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13929 RXN-13929] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13930 RXN-13930] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13932 RXN-13932] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13933 RXN-13933] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13934 RXN-13934] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8262 RXN-8262] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=polymethylated quercetin biosynthesis}} | |
| − | + | {{#set: taxonomic range=TAX-91827}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=9}} | |
| − | + | {{#set: completion rate=11.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 15:27, 9 January 2019
Pathway PWY-7161
- common name:
- polymethylated quercetin biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 9 reactions in the full pathway
- QUERCETIN-3-O-METHYLTRANSFERASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
