Difference between revisions of "CPD-18776"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18776 CPD-18776] == * smiles: ** COC1(C(=O)CC(CO)(O)CC(O)=1) * common name: ** (R)-4-deoxyg...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(C(=O)CC(CO)(O)CC(O)=1) | ** COC1(C(=O)CC(CO)(O)CC(O)=1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 188.18 | ** 188.18 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N | ||
+ | * common name: | ||
+ | ** (R)-4-deoxygadusol | ||
* Synonym(s): | * Synonym(s): | ||
Line 18: | Line 18: | ||
== External links == | == External links == | ||
{{#set: smiles=COC1(C(=O)CC(CO)(O)CC(O)=1)}} | {{#set: smiles=COC1(C(=O)CC(CO)(O)CC(O)=1)}} | ||
− | |||
− | |||
{{#set: molecular weight=188.18 }} | {{#set: molecular weight=188.18 }} | ||
+ | {{#set: inchi key=InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N}} | ||
+ | {{#set: common name=(R)-4-deoxygadusol}} | ||
{{#set: produced by=RXN-17366}} | {{#set: produced by=RXN-17366}} | ||
{{#set: reversible reaction associated=RXN-17370}} | {{#set: reversible reaction associated=RXN-17370}} |
Latest revision as of 16:02, 9 January 2019
Contents
Metabolite CPD-18776
- smiles:
- COC1(C(=O)CC(CO)(O)CC(O)=1)
- molecular weight:
- 188.18
- inchi key:
- InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N
- common name:
- (R)-4-deoxygadusol
- Synonym(s):